3-chloro-1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]-5-(trifluoromethyl)pyridin-2-one structure
|
Common Name | 3-chloro-1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]-5-(trifluoromethyl)pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 96741-18-3 | Molecular Weight | 377.06900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H4Cl2F6N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H4Cl2F6N2O |
|---|---|
| Molecular Weight | 377.06900 |
| Exact Mass | 375.96000 |
| PSA | 34.89000 |
| LogP | 4.57690 |
| InChIKey | ZZTAHKATRATLPG-UHFFFAOYSA-N |
| SMILES | O=c1c(Cl)cc(C(F)(F)F)cn1-c1ncc(C(F)(F)F)cc1Cl |
| HS Code | 2933399090 |
|---|
|
~78%
3-chloro-1-[3-c... CAS#:96741-18-3 |
| Literature: Sakamoto, Noriyasu; Kurita, Yasuyuki; Yanagi, Kazunori; Matsuo, Noritada Journal of Organic Chemistry, 2000 , vol. 65, # 4 p. 1225 - 1226 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Chloro-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-(trifluoromethyl)-2(1H)-pyridinone |
| [1(2H)-3-chloro-5-(trifluoromethyl)-3'-chloro-5'-(trifluoromethyl)-2'-bipyridin]-2-one |
| HMS578C03 |
| 3-chloro-1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]-5-(trifluoromethyl)pyridin-2(1h)-one |