N-(4-chlorophenyl)-3-methoxybenzamide structure
|
Common Name | N-(4-chlorophenyl)-3-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 96776-05-5 | Molecular Weight | 261.70400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-chlorophenyl)-3-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12ClNO2 |
|---|---|
| Molecular Weight | 261.70400 |
| Exact Mass | 261.05600 |
| PSA | 38.33000 |
| LogP | 3.67390 |
| InChIKey | PTEBQUFBDQXFFF-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 |
|
~73%
N-(4-chlorophen... CAS#:96776-05-5 |
| Literature: Lai, Ya-Yun; Huang, Li-Jiau; Lee, Kuo-Hsiung; Xiao, Zhiyan; Bastow, Kenneth F.; Yamori, Takao; Kuo, Sheng-Chu Bioorganic and Medicinal Chemistry, 2005 , vol. 13, # 1 p. 265 - 275 |
|
~%
N-(4-chlorophen... CAS#:96776-05-5 |
| Literature: Dhar, Durga N.; Gupta, Sudha R. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 533 - 535 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzamide,N-(4-chlorophenyl)-3-methoxy |
| 3-methoxyphenyl-N-(4-chlorophenyl)benzamide |
| 3-Methoxy-benzoesaeure-(4-chlor-anilid) |
| 3-methoxy-N-(4-chlorophenyl)benzamide |