[(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol
![[(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol Structure](https://image.chemsrc.com/caspic/283/96795-00-5.png)
[(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol structure
|
Common Name | [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 96795-00-5 | Molecular Weight | 331.38600 | |
| Density | 1.333g/cm3 | Boiling Point | 569.37ºC at 760 mmHg | |
| Molecular Formula | C17H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.144ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 569.37ºC at 760 mmHg |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.38600 |
| Flash Point | 298.144ºC |
| Exact Mass | 331.08800 |
| PSA | 84.34000 |
| LogP | 2.48550 |
| Index of Refraction | 1.627 |
| InChIKey | BOCXPQQPWOKDFW-HZPDHXFCSA-N |
| SMILES | CS(=O)(=O)c1ccc(C2OC(c3ccccc3)=NC2CO)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 2 | |
CAS#:100-47-0
CAS#:51458-28-7
CAS#:5333-86-8
CAS#:825-60-5
CAS#:98-88-4
CAS#:139164-32-2
CAS#:17087-39-7
CAS#:73231-34-2![(4S,5R)-4-(Fluoromethyl)-4,5-dihydro-5-[4-(methylsulfonyl)phenyl]-2-phenyloxazole structure](https://image.chemsrc.com/caspic/062/126428-97-5.png)
CAS#:126428-97-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol? |
| A: SMILES notation of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol is CS(=O)(=O)c1ccc(C2OC(c3ccccc3)=NC2CO)cc1. |
| Q: What is the CAS number of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol? |
| A: CAS number of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol is 96795-00-5. |
| Q: What is the InChIKey of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol? |
| A: InChIKey of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol is BOCXPQQPWOKDFW-HZPDHXFCSA-N. |
| Q: What is the molecular weight of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol? |
| A: Molecular weight of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol is 331.38600. |
| Q: What is the English name of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol? |
| A: The English name of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol is [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol. |
| Q: What is the LogP of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol? |
| A: LogP of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol is 2.48550. |
| Q: What is the boiling point of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol? |
| A: Boiling point of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol is 569.37ºC at 760 mmHg. |
| Q: What is the molecular formula of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol? |
| A: Molecular formula of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol is C17H17NO4S. |
| Q: What is the Chinese name of 96795-00-5? |
| A: Chinese name of 96795-00-5 is 96795-00-5. |
| Q: What are the downstream products of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol? |
| A: Related downstream products(CAS) of [(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol: 73231-34-2;126428-97-5. |