Androst-4-en-19-al,3,17-dioxo structure
|
Common Name | Androst-4-en-19-al,3,17-dioxo | ||
|---|---|---|---|---|
| CAS Number | 968-49-0 | Molecular Weight | 300.39200 | |
| Density | 1.18g/cm3 | Boiling Point | 471.3ºC at 760mmHg | |
| Molecular Formula | C19H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.7ºC | |
| Name | 3,17-dioxoandrost-4-en-19-al |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 471.3ºC at 760mmHg |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.39200 |
| Flash Point | 203.7ºC |
| Exact Mass | 300.17300 |
| PSA | 51.21000 |
| LogP | 3.26640 |
| Index of Refraction | 1.562 |
| InChIKey | XRCFMDPVHKVRDJ-BGJMDTOESA-N |
| SMILES | CC12CCC3C(CCC4=CC(=O)CCC43C=O)C1CCC2=O |
|
Name: Inhibition of aromatase in human placental microsomes using [1beta-3H]AD as substrate...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL5241253
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 19-oxo-androstenedione |
| 19-Oxoandrostendione |
| 19-oxo-androst-4-ene-3,17-dione |
| 19-aldoandrostenedione |
| 4-Androstene-3,17-dione-19-al |
| (8R,9S,10S,13S,14S)-13-methyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
| 4-androsten-19-al-3,17-dione |
| 19-Aldehydo-4-androstene-3,17-dione |