Androst-4-en-19-al,3,17-dioxo
Androst-4-en-19-al,3,17-dioxo structure
|
Common Name | Androst-4-en-19-al,3,17-dioxo | ||
|---|---|---|---|---|
| CAS Number | 968-49-0 | Molecular Weight | 300.39200 | |
| Density | 1.18g/cm3 | Boiling Point | 471.3ºC at 760mmHg | |
| Molecular Formula | C19H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.7ºC | |
Summary: 19-Androstenol, 3,17-dioxo (Androst-4-en-19-al, 3,17-dioxo-) with CAS number 968-49-0, has a molecular formula of C19H24O3 and a molecular weight of 300.39200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,17-dioxoandrost-4-en-19-al |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 471.3ºC at 760mmHg |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.39200 |
| Flash Point | 203.7ºC |
| Exact Mass | 300.17300 |
| PSA | 51.21000 |
| LogP | 3.26640 |
| Index of Refraction | 1.562 |
| InChIKey | XRCFMDPVHKVRDJ-BGJMDTOESA-N |
| SMILES | CC12CCC3C(CCC4=CC(=O)CCC43C=O)C1CCC2=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 8 | |
CAS#:1089-78-7
CAS#:3962-66-1
CAS#:510-64-5
CAS#:53-16-7
CAS#:734-32-7
CAS#:5189-96-8
CAS#:64-18-6
CAS#:22256-03-7This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of aromatase in human placental microsomes using [1beta-3H]AD as substrate...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL5241253
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 19-oxo-androstenedione |
| 19-Oxoandrostendione |
| 19-oxo-androst-4-ene-3,17-dione |
| 19-aldoandrostenedione |
| 4-Androstene-3,17-dione-19-al |
| (8R,9S,10S,13S,14S)-13-methyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
| 4-androsten-19-al-3,17-dione |
| 19-Aldehydo-4-androstene-3,17-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3,17-dioxoandrost-4-en-19-al have? |
| A: English synonyms of 3,17-dioxoandrost-4-en-19-al: 19-oxo-androstenedione, 19-Oxoandrostendione, 19-oxo-androst-4-ene-3,17-dione, 19-aldoandrostenedione, 4-Androstene-3,17-dione-19-al, (8R,9S,10S,13S,14S)-13-methyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde, 4-androsten-19-al-3,17-dione, 19-Aldehydo-4-androstene-3,17-dione. |
| Q: What are the downstream products of 3,17-dioxoandrost-4-en-19-al? |
| A: Related downstream products(CAS) of 3,17-dioxoandrost-4-en-19-al: 1089-78-7;3962-66-1;510-64-5;53-16-7;734-32-7;5189-96-8;64-18-6;22256-03-7. |
| Q: What is the English name of 3,17-dioxoandrost-4-en-19-al? |
| A: The English name of 3,17-dioxoandrost-4-en-19-al is 3,17-dioxoandrost-4-en-19-al. |
| Q: What is the LogP of 3,17-dioxoandrost-4-en-19-al? |
| A: LogP of 3,17-dioxoandrost-4-en-19-al is 3.26640. |
| Q: What is the SMILES notation of 3,17-dioxoandrost-4-en-19-al? |
| A: SMILES notation of 3,17-dioxoandrost-4-en-19-al is CC12CCC3C(CCC4=CC(=O)CCC43C=O)C1CCC2=O. |
| Q: What is the molecular weight of 3,17-dioxoandrost-4-en-19-al? |
| A: Molecular weight of 3,17-dioxoandrost-4-en-19-al is 300.39200. |
| Q: What is the molecular formula of 3,17-dioxoandrost-4-en-19-al? |
| A: Molecular formula of 3,17-dioxoandrost-4-en-19-al is C19H24O3. |
| Q: What is the CAS number of 3,17-dioxoandrost-4-en-19-al? |
| A: CAS number of 3,17-dioxoandrost-4-en-19-al is 968-49-0. |
| Q: What is the InChIKey of 3,17-dioxoandrost-4-en-19-al? |
| A: InChIKey of 3,17-dioxoandrost-4-en-19-al is XRCFMDPVHKVRDJ-BGJMDTOESA-N. |
| Q: What is the polar surface area (PSA) of 3,17-dioxoandrost-4-en-19-al? |
| A: Polar surface area (PSA) of 3,17-dioxoandrost-4-en-19-al is 51.21000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |