Austalide G
Modify Date: 2026-09-25 12:00:33
Austalide G structure
|
Common Name | Austalide G | ||
|---|---|---|---|---|
| CAS Number | 96817-09-3 | Molecular Weight | 518.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H38O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Austalide G |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H38O9 |
|---|---|
| Molecular Weight | 518.6 |
| InChIKey | ZOYRWINBLNBGCP-CRFIOEGSSA-N |
| SMILES | COC(=O)CCC1(C)C(C(C)(C)O)C(OC(C)=O)CC2(C)Oc3c(C)c4c(c(OC)c3CC21)C(=O)OC4 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Austalide G? |
| A: Molecular formula of Austalide G is C28H38O9. |
| Q: What is the InChIKey of Austalide G? |
| A: InChIKey of Austalide G is ZOYRWINBLNBGCP-CRFIOEGSSA-N. |
| Q: What is the English name of Austalide G? |
| A: The English name of Austalide G is Austalide G. |
| Q: What is the Chinese name of 96817-09-3? |
| A: Chinese name of 96817-09-3 is 96817-09-3. |
| Q: What is the SMILES notation of Austalide G? |
| A: SMILES notation of Austalide G is COC(=O)CCC1(C)C(C(C)(C)O)C(OC(C)=O)CC2(C)Oc3c(C)c4c(c(OC)c3CC21)C(=O)OC4. |
| Q: What is the molecular weight of Austalide G? |
| A: Molecular weight of Austalide G is 518.6. |
| Q: What is the CAS number of Austalide G? |
| A: CAS number of Austalide G is 96817-09-3. |