ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate
ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate structure
|
Common Name | ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 96849-99-9 | Molecular Weight | 196.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20O2 |
|---|---|
| Molecular Weight | 196.28600 |
| Exact Mass | 196.14600 |
| PSA | 26.30000 |
| LogP | 2.93200 |
| InChIKey | UMXBKVFQEPMZTB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(C)=CCCC1(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 2 | |
CAS#:23068-96-4
CAS#:23068-97-5
CAS#:141-79-7
CAS#:141-97-9![ethyl 7,9,9-trimethyl-1,4-dithiospiro[4.5]dec-6-ene-8-carboxylate Structure](https://image.chemsrc.com/caspic/231/62641-95-6.png)
CAS#:62641-95-6
CAS#:74-96-4
CAS#:564-24-9
CAS#:110995-22-7
CAS#:1501-06-0
CAS#:6627-74-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,6,6-Trimethyl-cyclohex-2-encarbonsaeure-aethylester |
| 2,6,6-trimethyl-cyclohex-2-enecarboxylic acid ethyl ester |
| 2,6,6-trimethyl-cyclohex-2-ene-1-carboxylic acid ethyl ester |
| 2-Cyclohexene-1-carboxylic acid,2,6,6-trimethyl-,ethyl ester |
| (+-)-2.6.6-Trimethyl-cyclohexen-(5)-carbonsaeure-(1)-aethylester |
| (+-)-2.6.6-trimethyl-cyclohexene-(5)-carboxylic acid-(1)-ethyl ester |
| Ethyl 2,6,6-trimethyl-2-cyclohexene-1-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate? |
| A: Related upstream materials(CAS) of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate: 23068-96-4;23068-97-5;141-79-7;141-97-9;62641-95-6;74-96-4;564-24-9;110995-22-7;1501-06-0. |
| Q: What is the CAS number of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate? |
| A: CAS number of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate is 96849-99-9. |
| Q: What is the LogP of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate? |
| A: LogP of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate is 2.93200. |
| Q: What is the English name of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate? |
| A: The English name of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate is ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate. |
| Q: What English synonyms does ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate have? |
| A: English synonyms of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate: 2,6,6-Trimethyl-cyclohex-2-encarbonsaeure-aethylester, 2,6,6-trimethyl-cyclohex-2-enecarboxylic acid ethyl ester, 2,6,6-trimethyl-cyclohex-2-ene-1-carboxylic acid ethyl ester, 2-Cyclohexene-1-carboxylic acid,2,6,6-trimethyl-,ethyl ester, (+-)-2.6.6-Trimethyl-cyclohexen-(5)-carbonsaeure-(1)-aethylester, (+-)-2.6.6-trimethyl-cyclohexene-(5)-carboxylic acid-(1)-ethyl ester, Ethyl 2,6,6-trimethyl-2-cyclohexene-1-carboxylate. |
| Q: What is the molecular formula of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate? |
| A: Molecular formula of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate is C12H20O2. |
| Q: What is the molecular weight of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate? |
| A: Molecular weight of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate is 196.28600. |
| Q: What is the polar surface area (PSA) of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate? |
| A: Polar surface area (PSA) of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate is 26.30000. |
| Q: What is the SMILES notation of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate? |
| A: SMILES notation of ethyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate is CCOC(=O)C1C(C)=CCCC1(C)C. |
| Q: What is the Chinese name of 96849-99-9? |
| A: Chinese name of 96849-99-9 is 96849-99-9. |