1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea
1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea structure
|
Common Name | 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 96859-49-3 | Molecular Weight | 344.81900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13ClN4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H13ClN4OS |
|---|---|
| Molecular Weight | 344.81900 |
| Exact Mass | 344.05000 |
| PSA | 98.08000 |
| LogP | 3.59230 |
| InChIKey | BNZVAGMQPLNUPM-UHFFFAOYSA-N |
| SMILES | Cc1nc2ccccc2c(=O)n1NC(=S)Nc1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(4-chlorophenyl)-N'-<2-methyl-4(3H)-quinazolinon-3-yl> thiourea |
| Thiourea,N-(4-chlorophenyl)-N'-(2-methyl-4-oxo-3(4H)-quinazolinyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea? |
| A: SMILES notation of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea is Cc1nc2ccccc2c(=O)n1NC(=S)Nc1ccc(Cl)cc1. |
| Q: What is the CAS number of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea? |
| A: CAS number of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea is 96859-49-3. |
| Q: What is the molecular weight of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea? |
| A: Molecular weight of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea is 344.81900. |
| Q: What is the Chinese name of 96859-49-3? |
| A: Chinese name of 96859-49-3 is 96859-49-3. |
| Q: What is the LogP of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea? |
| A: LogP of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea is 3.59230. |
| Q: What is the polar surface area (PSA) of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea? |
| A: Polar surface area (PSA) of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea is 98.08000. |
| Q: What is the English name of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea? |
| A: The English name of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea is 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea. |
| Q: What English synonyms does 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea have? |
| A: English synonyms of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea: N-(4-chlorophenyl)-N'- thiourea, Thiourea,N-(4-chlorophenyl)-N'-(2-methyl-4-oxo-3(4H)-quinazolinyl). |
| Q: What is the InChIKey of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea? |
| A: InChIKey of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea is BNZVAGMQPLNUPM-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea? |
| A: Related upstream materials(CAS) of 1-(4-chlorophenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)thiourea: 1898-06-2;2131-55-7;525-76-8;22814-92-2;106-47-8;676244-29-4;118-92-3. |