2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione
![2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione Structure](https://image.chemsrc.com/caspic/400/96885-23-3.png)
2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione structure
|
Common Name | 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 96885-23-3 | Molecular Weight | 399.44500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H21N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H21N5O2 |
|---|---|
| Molecular Weight | 399.44500 |
| Exact Mass | 399.17000 |
| PSA | 66.23000 |
| LogP | 2.95940 |
| InChIKey | AGGOHDPKTBLZPA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2cn3c4c(=O)n(C)c(=O)n(C)c4nc3n2-c2ccc(C)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Imidazo(2,1-f)purine-2,4(3H,8H)-dione,7,8-bis(4-methylphenyl)-1,3-dimethyl |
| 7,8-Bis(4-methylphenyl)-1,3-dimethyl-1H-imidazo(2,1-f)purine-2,4(3H,8H)-dione |
| 1H-Imidazo(2,1-f)purine-2,4(3H,8H)-dione,1,3-dimethyl-7,8-bis(4-methylphenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione? |
| A: SMILES notation of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione is Cc1ccc(-c2cn3c4c(=O)n(C)c(=O)n(C)c4nc3n2-c2ccc(C)cc2)cc1. |
| Q: What is the Chinese name of 96885-23-3? |
| A: Chinese name of 96885-23-3 is 96885-23-3. |
| Q: What English synonyms does 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione have? |
| A: English synonyms of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione: 1H-Imidazo(2,1-f)purine-2,4(3H,8H)-dione,7,8-bis(4-methylphenyl)-1,3-dimethyl, 7,8-Bis(4-methylphenyl)-1,3-dimethyl-1H-imidazo(2,1-f)purine-2,4(3H,8H)-dione, 1H-Imidazo(2,1-f)purine-2,4(3H,8H)-dione,1,3-dimethyl-7,8-bis(4-methylphenyl). |
| Q: What is the molecular weight of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione? |
| A: Molecular weight of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione is 399.44500. |
| Q: What is the LogP of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione? |
| A: LogP of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione is 2.95940. |
| Q: What is the English name of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione? |
| A: The English name of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione is 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione. |
| Q: What is the molecular formula of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione? |
| A: Molecular formula of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione is C23H21N5O2. |
| Q: What is the polar surface area (PSA) of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione? |
| A: Polar surface area (PSA) of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione is 66.23000. |
| Q: What is the CAS number of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione? |
| A: CAS number of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione is 96885-23-3. |
| Q: What is the InChIKey of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione? |
| A: InChIKey of 2,4-dimethyl-6,7-bis(4-methylphenyl)purino[7,8-a]imidazole-1,3-dione is AGGOHDPKTBLZPA-UHFFFAOYSA-N. |