4-methylbenzo[g]quinoline-5,10-dione structure
|
Common Name | 4-methylbenzo[g]quinoline-5,10-dione | ||
|---|---|---|---|---|
| CAS Number | 96889-94-0 | Molecular Weight | 223.22700 | |
| Density | 1.324g/cm3 | Boiling Point | 436.6ºC at 760mmHg | |
| Molecular Formula | C14H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.4ºC | |
| Name | 4-methylbenzo[g]quinoline-5,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 436.6ºC at 760mmHg |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.22700 |
| Flash Point | 218.4ºC |
| Exact Mass | 223.06300 |
| PSA | 47.03000 |
| LogP | 2.16540 |
| InChIKey | GVRYUHXXENMGEV-UHFFFAOYSA-N |
| SMILES | Cc1ccnc2c1C(=O)c1ccccc1C2=O |
|
~58%
4-methylbenzo[g... CAS#:96889-94-0 |
| Literature: Bracher, Franz Liebigs Annalen der Chemie, 1989 , p. 87 - 88 |
|
~79%
4-methylbenzo[g... CAS#:96889-94-0 |
| Literature: Perez, Jose Maria; Lopez-Alvarado, Pilar; Pascual-Alfonso, Eva; Avendano, Carmen; Menendez, J. Carlos Tetrahedron, 2000 , vol. 56, # 26 p. 4575 - 4583 |
|
~60%
4-methylbenzo[g... CAS#:96889-94-0 |
| Literature: Jiang, Chunhui; Xu, Min; Wang, Shaozhong; Wang, Huaqin; Yao, Zhu-Jun Journal of Organic Chemistry, 2010 , vol. 75, # 12 p. 4323 - 4325 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: Minimum inhibitory concentration against Proteus vulgaris
Source: ChEMBL
Target: Proteus vulgaris
External Id: CHEMBL831511
|
|
Name: Antimycobacterial activity against Mycobacterium sp.
Source: ChEMBL
Target: Mycobacterium sp.
External Id: CHEMBL5262816
|
|
Name: Cytotoxicity against human Raji cells assessed as cell viability at 10 molar ratio
Source: ChEMBL
Target: Raji
External Id: CHEMBL1018461
|
|
Name: Minimum inhibitory concentration against Staphylococcus aureus
Source: ChEMBL
Target: Staphylococcus aureus
External Id: CHEMBL830605
|
|
Name: In vitro anti-mycobacterial activity against Mycobacterium intracellular ATCC 23068.
Source: ChEMBL
Target: Mycobacterium intracellulare
External Id: CHEMBL751965
|
|
Name: In vitro antifungal activity against Aspergillus fumigatus ATCC 26934.
Source: ChEMBL
Target: Aspergillus fumigatus
External Id: CHEMBL648395
|
|
Name: Minimum inhibitory concentration against Pseudomonas aeruginosa
Source: ChEMBL
Target: Pseudomonas aeruginosa
External Id: CHEMBL830617
|
|
Name: Antimicrobial activity against Mycobacterium intracellulare
Source: ChEMBL
Target: Mycobacterium intracellulare
External Id: CHEMBL2438881
|
|
Name: Minimum inhibitory concentration against Bacillus subtilis
Source: ChEMBL
Target: Bacillus subtilis
External Id: CHEMBL875742
|
|
Name: Inhibition of alpha-glucosidase (unknown origin) using p-nitrophenyl alpha-D-glucosid...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4629203
|
| Cleistopholine |
| cleistopholin |
| 4-methyl-benzo[g]quinoline-5,10-dione |
| 4-methyl-1-azaanthraquinone |
| 1-aza-4-methylanthraquinone |