5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole
5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole structure
|
Common Name | 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole | ||
|---|---|---|---|---|
| CAS Number | 96907-62-9 | Molecular Weight | 265.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H15NO2 |
|---|---|
| Molecular Weight | 265.30700 |
| Exact Mass | 265.11000 |
| PSA | 35.26000 |
| LogP | 4.32560 |
| InChIKey | HLIXBAVJOUSZRZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cnc(-c3ccc(C)cc3)o2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
CAS#:62882-04-6
CAS#:696-62-8
CAS#:16208-17-6
CAS#:104-84-7
CAS#:1011-51-4
CAS#:1576-35-8
CAS#:123-11-5
CAS#:143949-80-8
CAS#:22693-32-9
CAS#:766-97-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-(4-Methoxy-phenyl)-2-p-tolyl-oxazol |
| Oxazole,5-(4-methoxyphenyl)-2-(4-methylphenyl) |
| 5-(4-methoxyphenyl)-2-(4-methylphenyl)oxazole |
| 5-(4-methoxy-phenyl)-2-p-tolyl-oxazole |
| 2-(4-tolyl)-5-(4-methoxyphenyl)oxazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 96907-62-9? |
| A: Chinese name of 96907-62-9 is 96907-62-9. |
| Q: What is the CAS number of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole? |
| A: CAS number of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole is 96907-62-9. |
| Q: What is the molecular weight of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole? |
| A: Molecular weight of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole is 265.30700. |
| Q: What is the polar surface area (PSA) of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole? |
| A: Polar surface area (PSA) of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole is 35.26000. |
| Q: What is the LogP of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole? |
| A: LogP of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole is 4.32560. |
| Q: What English synonyms does 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole have? |
| A: English synonyms of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole: 5-(4-Methoxy-phenyl)-2-p-tolyl-oxazol, Oxazole,5-(4-methoxyphenyl)-2-(4-methylphenyl), 5-(4-methoxyphenyl)-2-(4-methylphenyl)oxazole, 5-(4-methoxy-phenyl)-2-p-tolyl-oxazole, 2-(4-tolyl)-5-(4-methoxyphenyl)oxazole. |
| Q: What is the English name of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole? |
| A: The English name of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole is 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole. |
| Q: What are the upstream materials of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole? |
| A: Related upstream materials(CAS) of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole: 62882-04-6;696-62-8;16208-17-6;104-84-7;1011-51-4;1576-35-8;123-11-5;143949-80-8;22693-32-9;766-97-2. |
| Q: What is the molecular formula of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole? |
| A: Molecular formula of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole is C17H15NO2. |
| Q: What is the InChIKey of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole? |
| A: InChIKey of 5-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-oxazole is HLIXBAVJOUSZRZ-UHFFFAOYSA-N. |