Acetamide,N-(2-hydroxy-5-nitrophenyl) structure
|
Common Name | Acetamide,N-(2-hydroxy-5-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 97-60-9 | Molecular Weight | 196.16000 | |
| Density | 1.477g/cm3 | Boiling Point | 432.1ºC at 760mmHg | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.1ºC | |
| Name | N-(2-hydroxy-5-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.477g/cm3 |
|---|---|
| Boiling Point | 432.1ºC at 760mmHg |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16000 |
| Flash Point | 215.1ºC |
| Exact Mass | 196.04800 |
| PSA | 95.15000 |
| LogP | 1.85500 |
| Index of Refraction | 1.658 |
| InChIKey | GFHYFPARONGSCD-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc([N+](=O)[O-])ccc1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_HPP
|
| 2'-Hydroxy-5'-nitroacetanilide |
| 2-Acetamido-4-nitrophenol |
| Acetamide,N-(2-hydroxy-5-nitrophenyl) |
| F3146-1671 |
| N-{2-hydroxy-5-nitrophenyl}acetamide |