Propanoic acid,2-methyl-, 3,7-dimethyl-6-octen-1-yl ester structure
|
Common Name | Propanoic acid,2-methyl-, 3,7-dimethyl-6-octen-1-yl ester | ||
|---|---|---|---|---|
| CAS Number | 97-89-2 | Molecular Weight | 226.35500 | |
| Density | 0.875 g/mL at 25ºC(lit.) | Boiling Point | 253ºC(lit.) | |
| Molecular Formula | C14H26O2 | Melting Point | -22.4°C (estimate) | |
| MSDS | USA | Flash Point | >230 °F | |
| Name | Citronellyl Isobutyrate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.875 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 253ºC(lit.) |
| Melting Point | -22.4°C (estimate) |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.35500 |
| Flash Point | >230 °F |
| Exact Mass | 226.19300 |
| PSA | 26.30000 |
| LogP | 3.95820 |
| Index of Refraction | n20/D 1.442(lit.) |
| InChIKey | ZGPPERKMXSGYRK-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC(C)CCOC(=O)C(C)C |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| HS Code | 2915900090 |
|
~%
Propanoic acid,... CAS#:97-89-2 |
| Literature: Agricultural and Biological Chemistry, , vol. 44, # 11 p. 2731 - 2732 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 3,7-dimethyloct-6-enyl 2-methylpropanoate |
| EINECS 202-616-7 |
| MFCD00026443 |