Benzenesulfonamide,4-(3-methyl-5-phenyl-1h-pyrazol-1-yl)
Modify Date: 2025-10-11 17:50:37
Benzenesulfonamide,4-(3-methyl-5-phenyl-1h-pyrazol-1-yl) structure
|
Common Name | Benzenesulfonamide,4-(3-methyl-5-phenyl-1h-pyrazol-1-yl) | ||
|---|---|---|---|---|
| CAS Number | 970-12-7 | Molecular Weight | 313.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzenesulfonamide,4-(3-methyl-5-phenyl-1h-pyrazol-1-yl) |
|---|
| Molecular Formula | C16H15N3O2S |
|---|---|
| Molecular Weight | 313.4 |
| InChIKey | DGBHRXLUVJFCMS-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccccc2)n(-c2ccc(S(N)(=O)=O)cc2)n1 |
|
Name: Inhibitory concentration against human prostaglandin G/H synthase 2 at 25 degrees.
Source: ChEMBL
Target: Prostaglandin G/H synthase 2
External Id: CHEMBL769648
|
|
Name: Inhibitory activity against prostaglandin G/H synthase 2 (COX-2)
Source: ChEMBL
Target: Prostaglandin G/H synthase 2
External Id: CHEMBL879226
|
|
Name: Inhibitory activity against prostaglandin G/H synthase 1 (COX-1)
Source: ChEMBL
Target: Prostaglandin G/H synthase 1
External Id: CHEMBL873459
|
|
Name: Inhibitory constant against prostaglandin G/H synthase 2 (COX-2)
Source: ChEMBL
Target: Prostaglandin G/H synthase 2
External Id: CHEMBL764068
|
|
Name: In vitro inhibitory concentration required to block recombinant human prostaglandin G...
Source: ChEMBL
Target: Prostaglandin G/H synthase 1
External Id: CHEMBL772766
|
|
Name: Inhibitory constant against prostaglandin G/H synthase 1 (COX-1)
Source: ChEMBL
Target: Prostaglandin G/H synthase 1
External Id: CHEMBL764159
|
|
Name: In vitro inhibitory concentration required to block human recombinant prostaglandin G...
Source: ChEMBL
Target: Prostaglandin G/H synthase 2
External Id: CHEMBL763093
|
|
Name: Selectivity as log (IC50[COX-1]/IC50[COX-2]).
Source: ChEMBL
Target: N/A
External Id: CHEMBL852471
|
Total 8, Current Page 1 of 1
1