Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro
Modify Date: 2026-07-04 14:58:19
![Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro Structure](https://www.chemsrc.com/extcaspic/480/970-16-1.png)
Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro structure
|
Common Name | Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro | ||
|---|---|---|---|---|
| CAS Number | 970-16-1 | Molecular Weight | 313.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11F4N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11F4N3O |
|---|---|
| Molecular Weight | 313.25 |
| InChIKey | IBEJAKDTMQVKAF-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=Nc2c(F)c(F)c(O)c(F)c2F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro? |
| A: Molecular formula of Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro is C14H11F4N3O. |
| Q: What is the CAS number of Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro? |
| A: CAS number of Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro is 970-16-1. |
| Q: What is the Chinese name of 970-16-1? |
| A: Chinese name of 970-16-1 is 970-16-1. |
| Q: What is the molecular weight of Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro? |
| A: Molecular weight of Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro is 313.25. |
| Q: What is the English name of Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro? |
| A: The English name of Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro is Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro. |
| Q: What is the InChIKey of Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro? |
| A: InChIKey of Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro is IBEJAKDTMQVKAF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro? |
| A: SMILES notation of Phenol, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluoro is CN(C)c1ccc(N=Nc2c(F)c(F)c(O)c(F)c2F)cc1. |