4',7-DIMETHOXY-6-HYDROXYISOFLAVONE
4',7-DIMETHOXY-6-HYDROXYISOFLAVONE structure
|
Common Name | 4',7-DIMETHOXY-6-HYDROXYISOFLAVONE | ||
|---|---|---|---|---|
| CAS Number | 970-48-9 | Molecular Weight | 298.29000 | |
| Density | 1.321±0.06 g/cm3(20 °C , 760mmHg) | Boiling Point | 516.0±50.0 °C (760 mmHg) | |
| Molecular Formula | C17H14O5 | Melting Point | 246-247 °C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.321±0.06 g/cm3(20 °C , 760mmHg) |
|---|---|
| Boiling Point | 516.0±50.0 °C (760 mmHg) |
| Melting Point | 246-247 °C |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29000 |
| Exact Mass | 298.08400 |
| PSA | 68.90000 |
| LogP | 3.18280 |
| InChIKey | CQULNEWSZBPFNL-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2coc3cc(OC)c(O)cc3c2=O)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2914509090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Alfalone (isoflavone) |
| 6-Hydroxy-7,4'-dimethoxyisoflavone |
| Alfalone |
| 4',7-DIMETHOXY-6-HYDROXYISOFLAVONE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl) have? |
| A: English synonyms of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl): Alfalone (isoflavone), 6-Hydroxy-7,4'-dimethoxyisoflavone, Alfalone, 4',7-DIMETHOXY-6-HYDROXYISOFLAVONE. |
| Q: What is the CAS number of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl)? |
| A: CAS number of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl) is 970-48-9. |
| Q: What is the molecular weight of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl)? |
| A: Molecular weight of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl) is 298.29000. |
| Q: What is the English name of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl)? |
| A: The English name of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl) is 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl). |
| Q: What is the boiling point of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl)? |
| A: Boiling point of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl) is 516.0±50.0 °C (760 mmHg). |
| Q: What is the Chinese name of 970-48-9? |
| A: Chinese name of 970-48-9 is 970-48-9. |
| Q: What is the melting point of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl)? |
| A: Melting point of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl) is 246-247 °C. |
| Q: What is the molecular formula of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl)? |
| A: Molecular formula of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl) is C17H14O5. |
| Q: What is the LogP of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl)? |
| A: LogP of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl) is 3.18280. |
| Q: What is the SMILES notation of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl)? |
| A: SMILES notation of 4H-1-Benzopyran-4-one, 6-hydroxy-7-methoxy-3-(4-methoxyphenyl) is COc1ccc(-c2coc3cc(OC)c(O)cc3c2=O)cc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |