N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline
Modify Date: 2026-09-21 17:37:11
![N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline Structure](https://www.chemsrc.com/extcaspic/190/970-77-4.png)
N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline structure
|
Common Name | N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline | ||
|---|---|---|---|---|
| CAS Number | 970-77-4 | Molecular Weight | 306.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18N4O4 |
|---|---|
| Molecular Weight | 306.32 |
| InChIKey | XKNOKUFTDFQHDL-KIGJSBELSA-N |
| SMILES | CC=CCC(C)(C)C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline? |
| A: Molecular formula of N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline is C14H18N4O4. |
| Q: What is the SMILES notation of N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline? |
| A: SMILES notation of N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline is CC=CCC(C)(C)C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]. |
| Q: What is the CAS number of N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline? |
| A: CAS number of N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline is 970-77-4. |
| Q: What is the molecular weight of N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline? |
| A: Molecular weight of N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline is 306.32. |
| Q: What is the English name of N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline? |
| A: The English name of N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline is N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline. |
| Q: What is the Chinese name of 970-77-4? |
| A: Chinese name of 970-77-4 is 970-77-4. |
| Q: What is the InChIKey of N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline? |
| A: InChIKey of N-[[(E)-2,2-dimethylhex-4-enylidene]amino]-2,4-dinitroaniline is XKNOKUFTDFQHDL-KIGJSBELSA-N. |