2,2,6,6-Tetrabromo-1,1-Biphenyl structure
|
Common Name | 2,2,6,6-Tetrabromo-1,1-Biphenyl | ||
|---|---|---|---|---|
| CAS Number | 97038-96-5 | Molecular Weight | 469.79200 | |
| Density | 2.14g/cm3 | Boiling Point | 391.3ºC at 760mmHg | |
| Molecular Formula | C12H6Br4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.8ºC | |
| Name | 1,3-dibromo-2-(2,6-dibromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.14g/cm3 |
|---|---|
| Boiling Point | 391.3ºC at 760mmHg |
| Molecular Formula | C12H6Br4 |
| Molecular Weight | 469.79200 |
| Flash Point | 184.8ºC |
| Exact Mass | 465.72000 |
| LogP | 6.40360 |
| Index of Refraction | 1.666 |
| InChIKey | RAIZQBVLCDNAOH-UHFFFAOYSA-N |
| SMILES | Brc1cccc(Br)c1-c1c(Br)cccc1Br |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,2',6,6'-tetrabromobiphenyl |
| 2,6,2',6'-Tetrabrom-biphenyl |
| 1,1'-biphenyl,2,2',6,6'-tetrabromo |
| 2,6,2',6'-tetrabromobiphenyl |
| 2,2',6,6'-tetrabromodiphenyl |
| 2,2',6,6'-tetrabromo-1,1'-biphenyl |
| 2.2'.6.6'-Tetrabrom-biphenyl |