N-[2-Amino-4-(trifluoromethyl)phenyl]acetamide structure
|
Common Name | N-[2-Amino-4-(trifluoromethyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 97051-69-9 | Molecular Weight | 218.176 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 348.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H9F3N2O | Melting Point | 141ºC | |
| MSDS | N/A | Flash Point | 164.4±27.9 °C | |
| Name | N-[2-amino-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 348.3±42.0 °C at 760 mmHg |
| Melting Point | 141ºC |
| Molecular Formula | C9H9F3N2O |
| Molecular Weight | 218.176 |
| Flash Point | 164.4±27.9 °C |
| Exact Mass | 218.066696 |
| PSA | 55.12000 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | YBCKBOPAWVBWJH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(F)(F)F)cc1N |
| HS Code | 2924299090 |
|---|
|
~92%
N-[2-Amino-4-(t... CAS#:97051-69-9 |
| Literature: Kaiya; Fujiwara; Kohda Chemical Research in Toxicology, 2000 , vol. 13, # 10 p. 993 - 1001 |
|
~%
N-[2-Amino-4-(t... CAS#:97051-69-9 |
| Literature: Chemical Research in Toxicology, , vol. 13, # 10 p. 993 - 1001 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HMS1661K09 |
| N-[2-Amino-4-(trifluoromethyl)phenyl]acetamide |
| N1-[2-Amino-4-(trifluoromethyl)phenyl]acetamide |
| 2-amino-4-(trifluoromethyl)acetanilide |
| Acetamide, N-[2-amino-4-(trifluoromethyl)phenyl]- |
| 2'-Amino-4'-trifluormethylacetanilid |