1,4-dimethyl-3,5-dinitropyridin-2-one structure
|
Common Name | 1,4-dimethyl-3,5-dinitropyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 97055-58-8 | Molecular Weight | 213.14800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-dimethyl-3,5-dinitropyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7N3O5 |
|---|---|
| Molecular Weight | 213.14800 |
| Exact Mass | 213.03900 |
| PSA | 113.64000 |
| LogP | 1.55650 |
| InChIKey | OFKKJHUOJNUOBL-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])cn(C)c(=O)c1[N+](=O)[O-] |
|
~%
1,4-dimethyl-3,... CAS#:97055-58-8 |
| Literature: Ariga, Masahiro; Tohda, Yasuo; Matsumura, Eizo Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 1 p. 393 - 394 |
| 1,4-Dimethyl-3,5-dinitro-2-pyridone |
| 2(1H)-Pyridinone,1,4-dimethyl-3,5-dinitro |