1,4-dimethyl-3,5-dinitropyridin-2-one
1,4-dimethyl-3,5-dinitropyridin-2-one structure
|
Common Name | 1,4-dimethyl-3,5-dinitropyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 97055-58-8 | Molecular Weight | 213.14800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-dimethyl-3,5-dinitropyridin-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H7N3O5 |
|---|---|
| Molecular Weight | 213.14800 |
| Exact Mass | 213.03900 |
| PSA | 113.64000 |
| LogP | 1.55650 |
| InChIKey | OFKKJHUOJNUOBL-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])cn(C)c(=O)c1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,4-dimethyl-3,... CAS#:97055-58-8 |
| Literature: Ariga, Masahiro; Tohda, Yasuo; Matsumura, Eizo Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 1 p. 393 - 394 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 3 | |
CAS#:15513-52-7
CAS#:611-05-2
CAS#:139004-81-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-Dimethyl-3,5-dinitro-2-pyridone |
| 2(1H)-Pyridinone,1,4-dimethyl-3,5-dinitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,4-dimethyl-3,5-dinitropyridin-2-one? |
| A: The English name of 1,4-dimethyl-3,5-dinitropyridin-2-one is 1,4-dimethyl-3,5-dinitropyridin-2-one. |
| Q: What is the polar surface area (PSA) of 1,4-dimethyl-3,5-dinitropyridin-2-one? |
| A: Polar surface area (PSA) of 1,4-dimethyl-3,5-dinitropyridin-2-one is 113.64000. |
| Q: What is the SMILES notation of 1,4-dimethyl-3,5-dinitropyridin-2-one? |
| A: SMILES notation of 1,4-dimethyl-3,5-dinitropyridin-2-one is Cc1c([N+](=O)[O-])cn(C)c(=O)c1[N+](=O)[O-]. |
| Q: What are the upstream materials of 1,4-dimethyl-3,5-dinitropyridin-2-one? |
| A: Related upstream materials(CAS) of 1,4-dimethyl-3,5-dinitropyridin-2-one: 15031-42-2. |
| Q: What is the molecular weight of 1,4-dimethyl-3,5-dinitropyridin-2-one? |
| A: Molecular weight of 1,4-dimethyl-3,5-dinitropyridin-2-one is 213.14800. |
| Q: What is the InChIKey of 1,4-dimethyl-3,5-dinitropyridin-2-one? |
| A: InChIKey of 1,4-dimethyl-3,5-dinitropyridin-2-one is OFKKJHUOJNUOBL-UHFFFAOYSA-N. |
| Q: What are the downstream products of 1,4-dimethyl-3,5-dinitropyridin-2-one? |
| A: Related downstream products(CAS) of 1,4-dimethyl-3,5-dinitropyridin-2-one: 15513-52-7;611-05-2;139004-81-2. |
| Q: What is the CAS number of 1,4-dimethyl-3,5-dinitropyridin-2-one? |
| A: CAS number of 1,4-dimethyl-3,5-dinitropyridin-2-one is 97055-58-8. |
| Q: What English synonyms does 1,4-dimethyl-3,5-dinitropyridin-2-one have? |
| A: English synonyms of 1,4-dimethyl-3,5-dinitropyridin-2-one: 1,4-Dimethyl-3,5-dinitro-2-pyridone, 2(1H)-Pyridinone,1,4-dimethyl-3,5-dinitro. |
| Q: What is the LogP of 1,4-dimethyl-3,5-dinitropyridin-2-one? |
| A: LogP of 1,4-dimethyl-3,5-dinitropyridin-2-one is 1.55650. |