1,4-Dideoxy-1,4-Imino-D-Xylitol
Modify Date: 2026-06-25 16:00:47
1,4-Dideoxy-1,4-Imino-D-Xylitol structure
|
Common Name | 1,4-Dideoxy-1,4-Imino-D-Xylitol | ||
|---|---|---|---|---|
| CAS Number | 97058-12-3 | Molecular Weight | 133.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-Dideoxy-1,4-Imino-D-Xylitol |
|---|
| Molecular Formula | C5H11NO3 |
|---|---|
| Molecular Weight | 133.15 |
| InChIKey | OQEBIHBLFRADNM-WISUUJSJSA-N |
| SMILES | C1[C@@H]([C@H]([C@H](N1)CO)O)O |
|
Name: Antitubercular activity against Mycobacterium tuberculosis BCG after 7 days by alamar...
Source: ChEMBL
Target: Mycobacterium tuberculosis
External Id: CHEMBL3757479
|
|
Name: Inhibition of amylo-1,6-glucosidase at 1000 uM
Source: ChEMBL
Target: Glycogen debranching enzyme
External Id: CHEMBL923884
|
|
Name: Inhibition of rabbit muscle glycogen phosphorylase b
Source: ChEMBL
Target: N/A
External Id: CHEMBL923881
|
Total 3, Current Page 1 of 1
1