1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne
1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne structure
|
Common Name | 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne | ||
|---|---|---|---|---|
| CAS Number | 97071-87-9 | Molecular Weight | 336.76700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H32Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H32Si4 |
|---|---|
| Molecular Weight | 336.76700 |
| Exact Mass | 336.15800 |
| LogP | 4.99720 |
| InChIKey | AQUSVQUTBLGXHZ-UHFFFAOYSA-N |
| SMILES | C[Si]1(C)C#C[Si](C)(C)CC[Si](C)(C)C#C[Si](C)(C)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,1,4,4,7,7,10,... CAS#:97071-87-9
Detail
Learn More
|
| Literature: Kloster-Jensen, Else; Eliassen, Gudveig Aamdal Angewandte Chemie, 1985 , vol. 97, # 7 p. 587 - 588 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,3,6,6,9,9,12,12-octamethyl-3,6,9,12-tetrasilacyclododeca-1,7-diyne |
| 1,4,7,10-Tetrasilacyclododeca-2,8-diyne,1,1,4,4,7,7,10,10-octamethyl |
| 2,2,5,5,8,8,11,11-octamethyl-2,5,8,11-tetrasilacyclododeca-1,6-diyne |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne? |
| A: CAS number of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne is 97071-87-9. |
| Q: What is the InChIKey of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne? |
| A: InChIKey of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne is AQUSVQUTBLGXHZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne? |
| A: Molecular formula of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne is C16H32Si4. |
| Q: What is the English name of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne? |
| A: The English name of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne is 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne. |
| Q: What is the molecular weight of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne? |
| A: Molecular weight of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne is 336.76700. |
| Q: What are the upstream materials of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne? |
| A: Related upstream materials(CAS) of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne: 4301-15-9;13528-93-3. |
| Q: What is the LogP of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne? |
| A: LogP of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne is 4.99720. |
| Q: What is the Chinese name of 97071-87-9? |
| A: Chinese name of 97071-87-9 is 97071-87-9. |
| Q: What English synonyms does 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne have? |
| A: English synonyms of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne: 3,3,6,6,9,9,12,12-octamethyl-3,6,9,12-tetrasilacyclododeca-1,7-diyne, 1,4,7,10-Tetrasilacyclododeca-2,8-diyne,1,1,4,4,7,7,10,10-octamethyl, 2,2,5,5,8,8,11,11-octamethyl-2,5,8,11-tetrasilacyclododeca-1,6-diyne. |
| Q: What is the SMILES notation of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne? |
| A: SMILES notation of 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne is C[Si]1(C)C#C[Si](C)(C)CC[Si](C)(C)C#C[Si](C)(C)CC1. |