4-(5-fluoro-2-methylphenyl)-4-oxobutanoic acid structure
|
Common Name | 4-(5-fluoro-2-methylphenyl)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 97072-94-1 | Molecular Weight | 210.20200 | |
| Density | 1.243g/cm3 | Boiling Point | 378ºC at 760 mmHg | |
| Molecular Formula | C11H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.4ºC | |
| Name | 4-(5-fluoro-2-methylphenyl)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 378ºC at 760 mmHg |
| Molecular Formula | C11H11FO3 |
| Molecular Weight | 210.20200 |
| Flash Point | 182.4ºC |
| Exact Mass | 210.06900 |
| PSA | 54.37000 |
| LogP | 2.18160 |
| Index of Refraction | 1.526 |
| InChIKey | TYPYYKDDDSORJQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(F)cc1C(=O)CCC(=O)O |
| HS Code | 2918300090 |
|---|
|
~77%
4-(5-fluoro-2-m... CAS#:97072-94-1 |
| Literature: Mallory, Frank B.; Mallory, Clelia W. Journal of the American Chemical Society, 1985 , vol. 107, # 17 p. 4816 - 4819 |
|
~%
4-(5-fluoro-2-m... CAS#:97072-94-1 |
| Literature: Journal of the American Chemical Society, , vol. 107, # 17 p. 4816 - 4819 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(2-METHYL-5-FLUOROPHENYL)-4-OXOBUTYRIC ACID |
| 3-(5-fluoro-2-methylbenzoyl)propionic acid |