4,7-dimethyl-5,6-bis(phenylmethoxy)-1H-indole structure
|
Common Name | 4,7-dimethyl-5,6-bis(phenylmethoxy)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 97073-53-5 | Molecular Weight | 357.44500 | |
| Density | 1.176g/cm3 | Boiling Point | 537ºC at 760 mmHg | |
| Molecular Formula | C24H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189ºC | |
| Name | 4,7-dimethyl-5,6-bis(phenylmethoxy)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 537ºC at 760 mmHg |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.44500 |
| Flash Point | 189ºC |
| Exact Mass | 357.17300 |
| PSA | 34.25000 |
| LogP | 5.94270 |
| Index of Refraction | 1.647 |
| InChIKey | WAVCHVOKLORIOO-UHFFFAOYSA-N |
| SMILES | Cc1c(OCc2ccccc2)c(OCc2ccccc2)c(C)c2[nH]ccc12 |
| HS Code | 2933990090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,6-bis(benzyloxy)-4,7-dimethylindole |