3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl
Modify Date: 2025-08-31 17:56:39
3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl structure
|
Common Name | 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 97115-91-8 | Molecular Weight | 322.44100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H26O2 |
|---|---|
| Molecular Weight | 322.44100 |
| Exact Mass | 322.19300 |
| PSA | 18.46000 |
| LogP | 5.71680 |
| InChIKey | IWKVXLRKVGISRL-UHFFFAOYSA-N |
| SMILES | C=CCOc1c(C)cc(-c2cc(C)c(OCC=C)c(C)c2)cc1C |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,3',5,5'-tetramethyl-biphenyl-4,4'-diol diallyl ether |
| 3,5,3',5'-Tetramethyl-4,4'-diallyloxy-biphenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl have? |
| A: English synonyms of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl: 3,3',5,5'-tetramethyl-biphenyl-4,4'-diol diallyl ether, 3,5,3',5'-Tetramethyl-4,4'-diallyloxy-biphenyl. |
| Q: What is the SMILES notation of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl? |
| A: SMILES notation of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl is C=CCOc1c(C)cc(-c2cc(C)c(OCC=C)c(C)c2)cc1C. |
| Q: What is the InChIKey of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl? |
| A: InChIKey of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl is IWKVXLRKVGISRL-UHFFFAOYSA-N. |
| Q: What is the LogP of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl? |
| A: LogP of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl is 5.71680. |
| Q: What is the polar surface area (PSA) of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl? |
| A: Polar surface area (PSA) of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl is 18.46000. |
| Q: What is the molecular formula of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl? |
| A: Molecular formula of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl is C22H26O2. |
| Q: What is the Chinese name of 97115-91-8? |
| A: Chinese name of 97115-91-8 is 97115-91-8. |
| Q: What is the English name of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl? |
| A: The English name of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl is 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl. |
| Q: What is the molecular weight of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl? |
| A: Molecular weight of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl is 322.44100. |
| Q: What is the CAS number of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl? |
| A: CAS number of 3,3',5,5'-tetramethyl-4,4'-bis(2-propen-1-yloxy)-1,1'-biphenyl is 97115-91-8. |