1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole
1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole structure
|
Common Name | 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole | ||
|---|---|---|---|---|
| CAS Number | 97142-01-3 | Molecular Weight | 295.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H25NO |
|---|---|
| Molecular Weight | 295.41900 |
| Exact Mass | 295.19400 |
| PSA | 12.47000 |
| LogP | 5.10310 |
| InChIKey | SUYYOCUJOMBBJR-UHFFFAOYSA-N |
| SMILES | CC(ON1C(C)(C)c2ccccc2C1(C)C)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,1,3,3-tetrame... CAS#:97142-01-3 |
| Literature: Bowry; Ingold Journal of the American Chemical Society, 1992 , vol. 114, # 13 p. 4992 - 4996 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-phenyl-1-(1,1,3,3-tetramethylisoindolin-2-yloxy)ethane |
| 1H-Isoindole,2,3-dihydro-1,1,3,3-tetramethyl-2-(1-phenylethoxy) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole? |
| A: The English name of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole is 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole. |
| Q: What is the LogP of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole? |
| A: LogP of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole is 5.10310. |
| Q: What is the molecular formula of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole? |
| A: Molecular formula of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole is C20H25NO. |
| Q: What is the Chinese name of 97142-01-3? |
| A: Chinese name of 97142-01-3 is 97142-01-3. |
| Q: What is the InChIKey of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole? |
| A: InChIKey of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole is SUYYOCUJOMBBJR-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole? |
| A: CAS number of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole is 97142-01-3. |
| Q: What is the molecular weight of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole? |
| A: Molecular weight of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole is 295.41900. |
| Q: What is the SMILES notation of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole? |
| A: SMILES notation of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole is CC(ON1C(C)(C)c2ccccc2C1(C)C)c1ccccc1. |
| Q: What are the upstream materials of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole? |
| A: Related upstream materials(CAS) of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole: 2348-51-8. |
| Q: What is the polar surface area (PSA) of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole? |
| A: Polar surface area (PSA) of 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole is 12.47000. |