1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole structure
|
Common Name | 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole | ||
|---|---|---|---|---|
| CAS Number | 97142-01-3 | Molecular Weight | 295.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,3,3-tetramethyl-2-(1-phenylethoxy)isoindole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H25NO |
|---|---|
| Molecular Weight | 295.41900 |
| Exact Mass | 295.19400 |
| PSA | 12.47000 |
| LogP | 5.10310 |
| InChIKey | SUYYOCUJOMBBJR-UHFFFAOYSA-N |
| SMILES | CC(ON1C(C)(C)c2ccccc2C1(C)C)c1ccccc1 |
|
~%
1,1,3,3-tetrame... CAS#:97142-01-3 |
| Literature: Bowry; Ingold Journal of the American Chemical Society, 1992 , vol. 114, # 13 p. 4992 - 4996 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-phenyl-1-(1,1,3,3-tetramethylisoindolin-2-yloxy)ethane |
| 1H-Isoindole,2,3-dihydro-1,1,3,3-tetramethyl-2-(1-phenylethoxy) |