N,N-dimethyl-2-[4-[1-(2-methylphenyl)-2-phenylbut-1-enyl]phenoxy]ethanamine structure
|
Common Name | N,N-dimethyl-2-[4-[1-(2-methylphenyl)-2-phenylbut-1-enyl]phenoxy]ethanamine | ||
|---|---|---|---|---|
| CAS Number | 97150-96-4 | Molecular Weight | 385.54100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H31NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-dimethyl-2-[4-[1-(2-methylphenyl)-2-phenylbut-1-enyl]phenoxy]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H31NO |
|---|---|
| Molecular Weight | 385.54100 |
| Exact Mass | 385.24100 |
| PSA | 12.47000 |
| LogP | 6.30450 |
| InChIKey | OHAQKLWZPWVCPE-IMVLJIQESA-N |
| SMILES | CCC(=C(c1ccc(OCCN(C)C)cc1)c1ccccc1C)c1ccccc1 |
|
~%
N,N-dimethyl-2-... CAS#:97150-96-4 |
| Literature: Foster; Jarman; Leung; McCague; Leclercq; Devleeschouwer Journal of Medicinal Chemistry, 1985 , vol. 28, # 10 p. 1491 - 1497 |
|
~%
N,N-dimethyl-2-... CAS#:97150-96-4 |
| Literature: Foster; Jarman; Leung; McCague; Leclercq; Devleeschouwer Journal of Medicinal Chemistry, 1985 , vol. 28, # 10 p. 1491 - 1497 |
|
~%
N,N-dimethyl-2-... CAS#:97150-96-4 |
| Literature: Foster; Jarman; Leung; McCague; Leclercq; Devleeschouwer Journal of Medicinal Chemistry, 1985 , vol. 28, # 10 p. 1491 - 1497 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N-DIMETHYL-2-[4-[(Z)-1-(2-METHYLPHENYL)-2-PHENYL-BUT-1-ENYL]PHENOXY]ETHANAMINE |
| trans-(E)-1-<4-<2-(dimethylamino)ethoxy>phenyl>-1-(2-methylphenyl)-2-phenyl-1-butene |