2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine
![2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine Structure](https://image.chemsrc.com/caspic/457/97151-10-5.png)
2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine structure
|
Common Name | 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine | ||
|---|---|---|---|---|
| CAS Number | 97151-10-5 | Molecular Weight | 343.46100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H25NO |
|---|---|
| Molecular Weight | 343.46100 |
| Exact Mass | 343.19400 |
| PSA | 12.47000 |
| LogP | 5.21590 |
| InChIKey | PXOWMFOUQCRAAG-LYBHJNIJSA-N |
| SMILES | CN(C)CCOc1ccc(C(=Cc2ccccc2)c2ccccc2)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![(E,Z)-1-Bromo-2-[4-[2-(dimethylamino)ethoxy]phenyl]-1,2-diphenylethene structure](https://image.chemsrc.com/caspic/349/19118-19-5.png)
CAS#:19118-19-5This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibitory concentration against cytochrome P450 2D6
Source: ChEMBL
Target: Cytochrome P450 2D6
External Id: CHEMBL827154
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ethanamine,2-(4-((1E)-1,2-diphenylethenyl)phenoxy)-N,N-dimethyl |
| UNII-4542Y3O42A |
| 2-(4-((E)-1,2-Diphenylethenyl)phenoxy)-N,N-dimethylethanamine |
| Desethyl tamoxifen,(E) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine? |
| A: Molecular formula of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine is C24H25NO. |
| Q: What are the downstream products of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine? |
| A: Related downstream products(CAS) of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine: 19118-19-5. |
| Q: What is the InChIKey of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine? |
| A: InChIKey of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine is PXOWMFOUQCRAAG-LYBHJNIJSA-N. |
| Q: What is the molecular weight of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine? |
| A: Molecular weight of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine is 343.46100. |
| Q: What English synonyms does 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine have? |
| A: English synonyms of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine: Ethanamine,2-(4-((1E)-1,2-diphenylethenyl)phenoxy)-N,N-dimethyl, UNII-4542Y3O42A, 2-(4-((E)-1,2-Diphenylethenyl)phenoxy)-N,N-dimethylethanamine, Desethyl tamoxifen,(E). |
| Q: What is the polar surface area (PSA) of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine? |
| A: Polar surface area (PSA) of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine is 12.47000. |
| Q: What is the SMILES notation of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine? |
| A: SMILES notation of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine is CN(C)CCOc1ccc(C(=Cc2ccccc2)c2ccccc2)cc1. |
| Q: What is the Chinese name of 97151-10-5? |
| A: Chinese name of 97151-10-5 is 97151-10-5. |
| Q: What is the CAS number of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine? |
| A: CAS number of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine is 97151-10-5. |
| Q: What is the English name of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine? |
| A: The English name of 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine is 2-[4-[(Z)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine. |