4-Piperidinecarbonitrile,4-[(4-chlorophenyl)amino]-1-(phenylmethyl)- structure
|
Common Name | 4-Piperidinecarbonitrile,4-[(4-chlorophenyl)amino]-1-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 972-20-3 | Molecular Weight | 325.83500 | |
| Density | 1.22g/cm3 | Boiling Point | 508.7ºC at 760mmHg | |
| Molecular Formula | C19H20ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.4ºC | |
| Name | 1-benzyl-4-(4-chloroanilino)piperidine-4-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 508.7ºC at 760mmHg |
| Molecular Formula | C19H20ClN3 |
| Molecular Weight | 325.83500 |
| Flash Point | 261.4ºC |
| Exact Mass | 325.13500 |
| PSA | 39.06000 |
| LogP | 4.32118 |
| Index of Refraction | 1.628 |
| InChIKey | VVMOFVNFPBAHLP-UHFFFAOYSA-N |
| SMILES | N#CC1(Nc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~80%
Detail
|
| Literature: Luly, Jay R.; Nakasato, Yoshisuke; Ohshima, Etsuo; Harriman, Geraldine C.B.; Carson, Kenneth G.; Ghosh, Shomir; Elder, Amy M.; Mattia, Karen M. Patent: US2005/70549 A1, 2005 ; |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 213-545-6 |
| 1-Benzyl-4-cyano-4-p-chloranilinopiperidin |