octyl 3-chlorobenzoate structure
|
Common Name | octyl 3-chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 97221-99-3 | Molecular Weight | 268.77900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | octyl 3-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H21ClO2 |
|---|---|
| Molecular Weight | 268.77900 |
| Exact Mass | 268.12300 |
| PSA | 26.30000 |
| LogP | 4.85730 |
| InChIKey | WQNBXKKGVGKFPV-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)c1cccc(Cl)c1 |
|
~1%
octyl 3-chlorob... CAS#:97221-99-3 |
| Literature: Cambie, Richard C.; Chambers, David; Lindsay, Barry G.; Rutledge, Peter S.; Woodgate, Paul D. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 822 - 827 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| octyl m-chlorobenzoate |
| Benzoic acid,3-chloro,octyl ester |