5-benzylthiophene-2-sulfonyl chloride
Modify Date: 2026-08-21 10:48:16
5-benzylthiophene-2-sulfonyl chloride structure
|
Common Name | 5-benzylthiophene-2-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 97272-01-0 | Molecular Weight | 272.77100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9ClO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-benzylthiophene-2-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9ClO2S2 |
|---|---|
| Molecular Weight | 272.77100 |
| Exact Mass | 271.97300 |
| PSA | 70.76000 |
| LogP | 4.34720 |
| InChIKey | DFNBLHOMHGPJGW-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(Cc2ccccc2)s1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Thiophenesulfonyl chloride,5-(phenylmethyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-benzylthiophene-2-sulfonyl chloride? |
| A: SMILES notation of 5-benzylthiophene-2-sulfonyl chloride is O=S(=O)(Cl)c1ccc(Cc2ccccc2)s1. |
| Q: What is the LogP of 5-benzylthiophene-2-sulfonyl chloride? |
| A: LogP of 5-benzylthiophene-2-sulfonyl chloride is 4.34720. |
| Q: What is the Chinese name of 97272-01-0? |
| A: Chinese name of 97272-01-0 is 97272-01-0. |
| Q: What is the CAS number of 5-benzylthiophene-2-sulfonyl chloride? |
| A: CAS number of 5-benzylthiophene-2-sulfonyl chloride is 97272-01-0. |
| Q: What is the polar surface area (PSA) of 5-benzylthiophene-2-sulfonyl chloride? |
| A: Polar surface area (PSA) of 5-benzylthiophene-2-sulfonyl chloride is 70.76000. |
| Q: What English synonyms does 5-benzylthiophene-2-sulfonyl chloride have? |
| A: English synonyms of 5-benzylthiophene-2-sulfonyl chloride: 2-Thiophenesulfonyl chloride,5-(phenylmethyl). |
| Q: What is the InChIKey of 5-benzylthiophene-2-sulfonyl chloride? |
| A: InChIKey of 5-benzylthiophene-2-sulfonyl chloride is DFNBLHOMHGPJGW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-benzylthiophene-2-sulfonyl chloride? |
| A: Molecular formula of 5-benzylthiophene-2-sulfonyl chloride is C11H9ClO2S2. |
| Q: What is the English name of 5-benzylthiophene-2-sulfonyl chloride? |
| A: The English name of 5-benzylthiophene-2-sulfonyl chloride is 5-benzylthiophene-2-sulfonyl chloride. |
| Q: What is the molecular weight of 5-benzylthiophene-2-sulfonyl chloride? |
| A: Molecular weight of 5-benzylthiophene-2-sulfonyl chloride is 272.77100. |