(2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid structure
|
Common Name | (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 97294-25-2 | Molecular Weight | 232.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid |
|---|
| Molecular Formula | C13H16N2O2 |
|---|---|
| Molecular Weight | 232.27800 |
| Exact Mass | 232.12100 |
| PSA | 61.69000 |
| LogP | 2.53090 |
| InChIKey | XTRIRFWVSULCBP-WSZGUFMCSA-N |
| SMILES | CC(=Cc1ccccc1)CNN=C(C)C(=O)O |
|
~87%
(2E)-2-[[(E)-2-... CAS#:97294-25-2 |
| Literature: Wolff, Hans Peter; Kuehnle, Hans F. Journal of Medicinal Chemistry, 1985 , vol. 28, # 10 p. 1436 - 1440 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: Hypoglycemic activity was given as differences between the mean changes in blood gluc...
Source: ChEMBL
Target: Cavia porcellus
External Id: CHEMBL683944
|