(2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid
![(2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid Structure](https://image.chemsrc.com/caspic/470/97294-25-2.png)
(2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid structure
|
Common Name | (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 97294-25-2 | Molecular Weight | 232.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16N2O2 |
|---|---|
| Molecular Weight | 232.27800 |
| Exact Mass | 232.12100 |
| PSA | 61.69000 |
| LogP | 2.53090 |
| InChIKey | XTRIRFWVSULCBP-WSZGUFMCSA-N |
| SMILES | CC(=Cc1ccccc1)CNN=C(C)C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~87%
(2E)-2-[[(E)-2-... CAS#:97294-25-2 |
| Literature: Wolff, Hans Peter; Kuehnle, Hans F. Journal of Medicinal Chemistry, 1985 , vol. 28, # 10 p. 1436 - 1440 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Hypoglycemic activity was given as differences between the mean changes in blood gluc...
Source: ChEMBL
Target: Cavia porcellus
External Id: CHEMBL683944
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid? |
| A: InChIKey of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid is XTRIRFWVSULCBP-WSZGUFMCSA-N. |
| Q: What is the molecular formula of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid? |
| A: Molecular formula of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid is C13H16N2O2. |
| Q: What is the Chinese name of 97294-25-2? |
| A: Chinese name of 97294-25-2 is 97294-25-2. |
| Q: What is the polar surface area (PSA) of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid? |
| A: Polar surface area (PSA) of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid is 61.69000. |
| Q: What is the CAS number of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid? |
| A: CAS number of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid is 97294-25-2. |
| Q: What is the molecular weight of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid? |
| A: Molecular weight of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid is 232.27800. |
| Q: What are the upstream materials of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid? |
| A: Related upstream materials(CAS) of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid: 127-17-3. |
| Q: What is the SMILES notation of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid? |
| A: SMILES notation of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid is CC(=Cc1ccccc1)CNN=C(C)C(=O)O. |
| Q: What is the LogP of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid? |
| A: LogP of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid is 2.53090. |
| Q: What is the English name of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid? |
| A: The English name of (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid is (2E)-2-[[(E)-2-methyl-3-phenylprop-2-enyl]hydrazinylidene]propanoic acid. |