Dithiophosphoric acid O,O-diethyl S-[(4-chlorophenyl)phenylmethyl] ester structure
|
Common Name | Dithiophosphoric acid O,O-diethyl S-[(4-chlorophenyl)phenylmethyl] ester | ||
|---|---|---|---|---|
| CAS Number | 973-28-4 | Molecular Weight | 386.89600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20ClO2PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(4-chlorophenyl)-phenylmethyl]sulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H20ClO2PS2 |
|---|---|
| Molecular Weight | 386.89600 |
| Exact Mass | 386.03300 |
| PSA | 85.66000 |
| LogP | 7.11070 |
| InChIKey | IQXFUWXKKYVIGJ-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SC(c1ccccc1)c1ccc(Cl)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| r-3828 |