1-(bromomethyl)-3-[3-(bromomethyl)-2-methoxyphenyl]-2-methoxybenzene structure
|
Common Name | 1-(bromomethyl)-3-[3-(bromomethyl)-2-methoxyphenyl]-2-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 97352-55-1 | Molecular Weight | 400.10500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(bromomethyl)-3-[3-(bromomethyl)-2-methoxyphenyl]-2-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16Br2O2 |
|---|---|
| Molecular Weight | 400.10500 |
| Exact Mass | 397.95200 |
| PSA | 18.46000 |
| LogP | 5.16060 |
| InChIKey | BYQCMNUVFFVNAV-UHFFFAOYSA-N |
| SMILES | COc1c(CBr)cccc1-c1cccc(CBr)c1OC |
|
~66%
1-(bromomethyl)... CAS#:97352-55-1 |
| Literature: Kaneda, Takahiro; Umeda, Shin'ichi; Tanigawa, Hisako; Misumi, Soichi; Kai, Yasushi; et al. Journal of the American Chemical Society, 1985 , vol. 107, # 16 p. 4802 - 4803 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,1'-Biphenyl,3,3'-bis(bromomethyl)-2,2'-dimethoxy |