methyl 1-(benzenesulfonyl)cyclopropane-1-carboxylate structure
|
Common Name | methyl 1-(benzenesulfonyl)cyclopropane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 97383-42-1 | Molecular Weight | 240.27600 | |
| Density | 1.361g/cm3 | Boiling Point | 393.2ºC at 760 mmHg | |
| Molecular Formula | C11H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | methyl 1-(benzenesulfonyl)cyclopropane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 393.2ºC at 760 mmHg |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.27600 |
| Flash Point | 191.6ºC |
| Exact Mass | 240.04600 |
| PSA | 68.82000 |
| LogP | 2.24670 |
| Index of Refraction | 1.577 |
| InChIKey | OACLWBSJZSLACO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(S(=O)(=O)c2ccccc2)CC1 |
|
~98%
methyl 1-(benze... CAS#:97383-42-1 |
| Literature: Takahashi, Masahiko; Suzuki, Hideo; Kata, Yoshimi Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 2 p. 765 - 766 |
|
~%
methyl 1-(benze... CAS#:97383-42-1 |
| Literature: Takahashi, Masahiko; Suzuki, Hideo; Kata, Yoshimi Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 2 p. 765 - 766 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methyl 1-phenylsulfonylcyclopropanecarboxylate |
| Cyclopropanecarboxylic acid,1-(phenylsulfonyl)-,methyl ester |