methyl acetate, compound with N,N-diethyl-4-[(4-methyl-4H-1,2,4-triazol-3-yl)azo]aniline (1:1) structure
|
Common Name | methyl acetate, compound with N,N-diethyl-4-[(4-methyl-4H-1,2,4-triazol-3-yl)azo]aniline (1:1) | ||
|---|---|---|---|---|
| CAS Number | 97404-01-8 | Molecular Weight | 332.40100 | |
| Density | N/A | Boiling Point | 484.4ºC at 760 mmHg | |
| Molecular Formula | C16H24N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.7ºC | |
| Name | N,N-diethyl-4-[(4-methyl-1,2,4-triazol-3-yl)diazenyl]aniline,methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 484.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.40100 |
| Flash Point | 246.7ºC |
| Exact Mass | 332.19600 |
| PSA | 84.97000 |
| LogP | 3.25600 |
| InChIKey | YWEYCJCTVIMUKD-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(N=Nc2nncn2C)cc1.COC(C)=O |
| einecs 306-763-9 |