3,8-dichloro-5,10-bis[(3-chlorophenyl)amino]pyrene-1,6-dione structure
|
Common Name | 3,8-dichloro-5,10-bis[(3-chlorophenyl)amino]pyrene-1,6-dione | ||
|---|---|---|---|---|
| CAS Number | 97404-17-6 | Molecular Weight | 552.23500 | |
| Density | 1.62g/cm3 | Boiling Point | 722.2ºC at 760mmHg | |
| Molecular Formula | C28H14Cl4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 390.6ºC | |
| Name | 3,8-dichloro-5,10-bis(3-chloroanilino)pyrene-1,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 722.2ºC at 760mmHg |
| Molecular Formula | C28H14Cl4N2O2 |
| Molecular Weight | 552.23500 |
| Flash Point | 390.6ºC |
| Exact Mass | 549.98100 |
| PSA | 58.20000 |
| LogP | 9.33180 |
| Index of Refraction | 1.787 |
| InChIKey | PVXYSEDCHQONLQ-UHFFFAOYSA-N |
| SMILES | O=c1cc(Cl)c2cc(=Nc3cccc(Cl)c3)c3c(O)cc(Cl)c4cc(Nc5cccc(Cl)c5)c1c-2c43 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3,8-dichloro-5,10-bis-(3-chloro-anilino)-pyrene-1,6-dione |
| 3.8-Dichlor-5.10-bis-(3-chlor-anilino)-pyren-chinon-(1.6) |
| 3,8-Dichlor-5,10-bis-(3-chlor-anilino)-pyren-1,6-dion |
| 3,8-dichloro-5,10-bis[(3-chlorophenyl)amino]pyrene-1,6-dione |
| EINECS 306-780-1 |