3,6-di(tert-butyl)naphthalene-1-sulphonic acid, compound with 10-[(dimethylamino)acetyl]-10H-phenothiazine (1:1) structure
|
Common Name | 3,6-di(tert-butyl)naphthalene-1-sulphonic acid, compound with 10-[(dimethylamino)acetyl]-10H-phenothiazine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 97434-76-9 | Molecular Weight | 604.82200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H40N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-ditert-butylnaphthalene-1-sulfonic acid,2-(dimethylamino)-1-phenothiazin-10-ylethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H40N2O4S2 |
|---|---|
| Molecular Weight | 604.82200 |
| Exact Mass | 604.24300 |
| PSA | 111.60000 |
| LogP | 9.20480 |
| InChIKey | JXZQPAURAZMEDH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2c(S(=O)(=O)O)cc(C(C)(C)C)cc2c1.CN(C)CC(=O)N1c2ccccc2Sc2ccccc21 |
| EINECS 306-853-8 |
| 3,6-Di(tert-butyl)naphthalene-1-sulphonic acid,compound with 10-((dimethylamino)acetyl)-10H-phenothiazine (1:1) |