4-[1-(4-chlorophenyl)hexoxy]-4-oxobutanoic acid structure
|
Common Name | 4-[1-(4-chlorophenyl)hexoxy]-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 97492-92-7 | Molecular Weight | 312.78900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[1-(4-chlorophenyl)hexoxy]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H21ClO4 |
|---|---|
| Molecular Weight | 312.78900 |
| Exact Mass | 312.11300 |
| PSA | 63.60000 |
| LogP | 4.36940 |
| InChIKey | NPIZSKPGNBPLAQ-UHFFFAOYSA-N |
| SMILES | CCCCCC(OC(=O)CCC(=O)O)c1ccc(Cl)cc1 |
|
~%
4-[1-(4-chlorop... CAS#:97492-92-7 |
| Literature: Palazzo,G. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1961 , vol. 4, # 3 p. 447 - 456 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| AF 563 |
| Bernsteinsaeure-mono-<1-(4-chlor-phenyl)-hexylester> |