2-(2-(1H-Indol-3-yl)-2-oxoacetamido)propanoic acid
Modify Date: 2026-06-26 20:04:22
2-(2-(1H-Indol-3-yl)-2-oxoacetamido)propanoic acid structure
|
Common Name | 2-(2-(1H-Indol-3-yl)-2-oxoacetamido)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 97500-63-5 | Molecular Weight | 260.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-(1H-Indol-3-yl)-2-oxoacetamido)propanoic acid |
|---|
| Molecular Formula | C13H12N2O4 |
|---|---|
| Molecular Weight | 260.24 |
| InChIKey | BLCWHIJOIFCPLC-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)C(=O)C1=CNC2=CC=CC=C21 |
|
Name: Inhibition of specific [3H]flunitrazepam binding to benzodiazepine receptor at 250 uM
Source: ChEMBL
Target: Gamma-aminobutyric acid receptor subunit alpha-4
External Id: CHEMBL654248
|
|
Name: Inhibitory concentration against [3H]flunitrazepam binding to benzodiazepine receptor...
Source: ChEMBL
Target: Gamma-aminobutyric acid receptor subunit alpha-4
External Id: CHEMBL883335
|
|
Name: Percentage inhibition of [3H]flunitrazepam binding to benzodiazepine receptor from bo...
Source: ChEMBL
Target: Gamma-aminobutyric acid receptor subunit alpha-4
External Id: CHEMBL652655
|
Total 3, Current Page 1 of 1
1