2-[bis(methylsulfanyl)methylidene]-1-(4-methylphenyl)pent-4-en-1-one structure
|
Common Name | 2-[bis(methylsulfanyl)methylidene]-1-(4-methylphenyl)pent-4-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 97510-26-4 | Molecular Weight | 278.43300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[bis(methylsulfanyl)methylidene]-1-(4-methylphenyl)pent-4-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H18OS2 |
|---|---|
| Molecular Weight | 278.43300 |
| Exact Mass | 278.08000 |
| PSA | 67.67000 |
| LogP | 4.69140 |
| InChIKey | VJUUGEPLHNUWON-UHFFFAOYSA-N |
| SMILES | C=CCC(C(=O)c1ccc(C)cc1)=C(SC)SC |
|
~63%
2-[bis(methylsu... CAS#:97510-26-4 |
| Literature: Apparao, Satyam; Bhattacharjee, Shakti S.; Ila, Hiriyakkanavar; Junjappa, Hiriyakkanavar Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 641 - 646 |
|
~%
2-[bis(methylsu... CAS#:97510-26-4 |
| Literature: Apparao, Satyam; Bhattacharjee, Shakti S.; Ila, Hiriyakkanavar; Junjappa, Hiriyakkanavar Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 641 - 646 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-allyl-3,3-bis(methylthio)-1-(p-methylphenyl)prop-2-en-1-one |
| 4-Penten-1-one,2-[bis(methylthio)methylene]-1-(4-methylphenyl) |