boc-trp-n(och3)ch3 structure
|
Common Name | boc-trp-n(och3)ch3 | ||
|---|---|---|---|---|
| CAS Number | 97530-05-7 | Molecular Weight | 347.40900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H25N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | boc-trp-n(och3)ch3 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H25N3O4 |
|---|---|
| Molecular Weight | 347.40900 |
| Exact Mass | 347.18500 |
| PSA | 83.66000 |
| LogP | 3.01440 |
| InChIKey | QJSOEMRUQKOCCR-HNNXBMFYSA-N |
| SMILES | CON(C)C(=O)C(Cc1c[nH]c2ccccc12)NC(=O)OC(C)(C)C |
| Storage condition | Store at 0°C |
|
~95%
boc-trp-n(och3)ch3 CAS#:97530-05-7 |
| Literature: Noda, Masaki; Ibuka, Toshiro; Habashita, Hiromu; Fujii, Nobutaka Chemical and Pharmaceutical Bulletin, 1997 , vol. 45, # 8 p. 1259 - 1264 |
|
~80%
boc-trp-n(och3)ch3 CAS#:97530-05-7 |
| Literature: Falkiewicz; Wisniowski; Kolodziejczyk; Wisniewski Nucleosides, Nucleotides and Nucleic Acids, 2001 , vol. 20, # 4-7 p. 1393 - 1397 |
|
~%
boc-trp-n(och3)ch3 CAS#:97530-05-7 |
| Literature: Ciapetti, Paola; Taddei, Maurizio; Ulivi, Paola Tetrahedron Letters, 1994 , vol. 35, # 19 p. 3183 - 3186 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (tert-butyloxycarbonyl)-L-tryptophan N,O-dimethylhydroxamate |
| BOC-TRP-NME(OME) |
| N-{[(1,1-dimethylethyl)oxy]carbonyl}-N-methyl-N-(methyloxy)-L-tryptophanamide |
| BOC-L-TRYPTOPHAN N-METHOXY-N-METHYL AMIDE |
| Boc-L-Trp-N(CH3)OCH3 |