3-hydroxynaphtho[3,2-b][1]benzofuran-6,11-dione structure
|
Common Name | 3-hydroxynaphtho[3,2-b][1]benzofuran-6,11-dione | ||
|---|---|---|---|---|
| CAS Number | 97620-82-1 | Molecular Weight | 264.23200 | |
| Density | 1.515g/cm3 | Boiling Point | 362.5ºC at 760mmHg | |
| Molecular Formula | C16H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.1ºC | |
| Name | 3-hydroxynaphtho[3,2-b][1]benzofuran-6,11-dione |
|---|
| Density | 1.515g/cm3 |
|---|---|
| Boiling Point | 362.5ºC at 760mmHg |
| Molecular Formula | C16H8O4 |
| Molecular Weight | 264.23200 |
| Flash Point | 173.1ºC |
| Exact Mass | 264.04200 |
| PSA | 67.51000 |
| LogP | 2.91380 |
| Index of Refraction | 1.744 |
| InChIKey | CRJFVPJRQFLPOZ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c1oc1cc(O)ccc21 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |