1-(2,6-dichlorophenyl)-3-pyridin-4-ylurea structure
|
Common Name | 1-(2,6-dichlorophenyl)-3-pyridin-4-ylurea | ||
|---|---|---|---|---|
| CAS Number | 97627-17-3 | Molecular Weight | 282.12500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9Cl2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,6-dichlorophenyl)-3-pyridin-4-ylurea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9Cl2N3O |
|---|---|
| Molecular Weight | 282.12500 |
| Exact Mass | 281.01200 |
| PSA | 60.74000 |
| LogP | 3.46790 |
| InChIKey | PVKLVNYMLMHFLL-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccncc1)Nc1c(Cl)cccc1Cl |
| HS Code | 2933399090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Anticonvulsant activity against tonic extension produced by maximal electroshock in m...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL739193
|
|
Name: Protective activity against Maximal Electroshock seizures(MES) at 60 min was determin...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL736810
|
|
Name: Anticonvulsant activity against tonic extension produced by maximal electroshock in m...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL743105
|
|
Name: The compound was tested for Ataxia(ATAX) by the inverted screen test, after intraperi...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL741476
|
| N-(2,6-Dichlorophenyl)-N'-(pyridin-4-yl)urea |
| N-(2,6-Dichlorophenyl)-N'-(4-pyridyl)urea |
| Urea,N-(2,6-dichlorophenyl)-N'-4-pyridinyl |
| N-(2,6-dichlorophenyl)-N'-4-pyridinyl urea |