5-oxo-DL-proline, compound with DL-lysine (1:1)
Modify Date: 2025-08-25 17:03:53
5-oxo-DL-proline, compound with DL-lysine (1:1) structure
|
Common Name | 5-oxo-DL-proline, compound with DL-lysine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 97635-56-8 | Molecular Weight | 275.30200 | |
| Density | N/A | Boiling Point | 624.4ºC at 760mmHg | |
| Molecular Formula | C11H21N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.4ºC | |
| Name | 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 624.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.30200 |
| Flash Point | 331.4ºC |
| Exact Mass | 275.14800 |
| PSA | 159.23000 |
| LogP | 0.55340 |
| InChIKey | GSTSUZHIVMCRLR-UHFFFAOYSA-N |
| SMILES | NCCCCC(N)C(=O)O.O=C1CCC(C(=O)O)N1 |
| EINECS 307-418-5 |
| 5-Oxo-DL-proline,compound with DL-lysine (1:1) |