5-oxo-DL-proline, compound with DL-lysine (1:1)
Modify Date: 2026-08-20 13:29:31
5-oxo-DL-proline, compound with DL-lysine (1:1) structure
|
Common Name | 5-oxo-DL-proline, compound with DL-lysine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 97635-56-8 | Molecular Weight | 275.30200 | |
| Density | N/A | Boiling Point | 624.4ºC at 760mmHg | |
| Molecular Formula | C11H21N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 624.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.30200 |
| Flash Point | 331.4ºC |
| Exact Mass | 275.14800 |
| PSA | 159.23000 |
| LogP | 0.55340 |
| InChIKey | GSTSUZHIVMCRLR-UHFFFAOYSA-N |
| SMILES | NCCCCC(N)C(=O)O.O=C1CCC(C(=O)O)N1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 307-418-5 |
| 5-Oxo-DL-proline,compound with DL-lysine (1:1) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid? |
| A: Polar surface area (PSA) of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid is 159.23000. |
| Q: What is the LogP of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid? |
| A: LogP of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid is 0.55340. |
| Q: What is the CAS number of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid? |
| A: CAS number of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid is 97635-56-8. |
| Q: What is the SMILES notation of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid? |
| A: SMILES notation of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid is NCCCCC(N)C(=O)O.O=C1CCC(C(=O)O)N1. |
| Q: What is the molecular weight of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid? |
| A: Molecular weight of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid is 275.30200. |
| Q: What is the boiling point of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid? |
| A: Boiling point of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid is 624.4ºC at 760mmHg. |
| Q: What is the InChIKey of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid? |
| A: InChIKey of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid is GSTSUZHIVMCRLR-UHFFFAOYSA-N. |
| Q: What English synonyms does 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid have? |
| A: English synonyms of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid: EINECS 307-418-5, 5-Oxo-DL-proline,compound with DL-lysine (1:1). |
| Q: What is the molecular formula of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid? |
| A: Molecular formula of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid is C11H21N3O5. |
| Q: What is the English name of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid? |
| A: The English name of 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid is 2,6-diaminohexanoic acid,5-oxopyrrolidine-2-carboxylic acid. |