N-ethyl-4-methoxy-N-(4-methoxyphenyl)benzenesulfonamide structure
|
Common Name | N-ethyl-4-methoxy-N-(4-methoxyphenyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 97637-06-4 | Molecular Weight | 321.39100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-ethyl-4-methoxy-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H19NO4S |
|---|---|
| Molecular Weight | 321.39100 |
| Exact Mass | 321.10300 |
| PSA | 64.22000 |
| LogP | 3.99980 |
| InChIKey | PVYAGTUYJKNYFM-UHFFFAOYSA-N |
| SMILES | CCN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(OC)cc1 |
|
~86%
N-ethyl-4-metho... CAS#:97637-06-4 |
| Literature: Stauffer, Shaun R.; Sun, Jun; Katzenellenbogen, Benita S.; Katzenellenbogen, John A. Bioorganic and Medicinal Chemistry, 2000 , vol. 8, # 6 p. 1293 - 1316 |
|
~%
N-ethyl-4-metho... CAS#:97637-06-4 |
| Literature: Stauffer, Shaun R.; Sun, Jun; Katzenellenbogen, Benita S.; Katzenellenbogen, John A. Bioorganic and Medicinal Chemistry, 2000 , vol. 8, # 6 p. 1293 - 1316 |
|
~%
N-ethyl-4-metho... CAS#:97637-06-4 |
| Literature: Stauffer, Shaun R.; Sun, Jun; Katzenellenbogen, Benita S.; Katzenellenbogen, John A. Bioorganic and Medicinal Chemistry, 2000 , vol. 8, # 6 p. 1293 - 1316 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(4-methoxyphenyl)-N-(ethyl)-4-methoxybenzene sulfonamide |
| 4-Methoxy-benzolsulfonsaeure-N-ethyl-p-anisidid |
| Benzenesulfonamide,N-ethyl-4-methoxy-N-(4-methoxyphenyl) |
| N-Ethyl-4-methoxy-N-(4-methoxy-phenyl)-benzenesulfonamide |