Lipoxin A4 methyl ester structure
|
Common Name | Lipoxin A4 methyl ester | ||
|---|---|---|---|---|
| CAS Number | 97643-35-1 | Molecular Weight | 366.492 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 540.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H34O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.5±23.6 °C | |
Use of Lipoxin A4 methyl esterLipoxin A4 methyl ester (LXA4 methyl ester) is a more lipid soluble, prodrug formulation of the transcellular metabolite LXA4. |
| Name | 5(s),6(r),15(s)-trihete methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 540.2±50.0 °C at 760 mmHg |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.492 |
| Flash Point | 180.5±23.6 °C |
| Exact Mass | 366.240631 |
| PSA | 86.99000 |
| LogP | 2.89 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | UBPCKDCSZPRQJP-QDCMSWGPSA-N |
| SMILES | CCCCCC(O)C=CC=CC=CC=CC(O)C(O)CCCC(=O)OC |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| lipoxin A methyl ester |
| 5S,6R,15S-TRIHYDROXY-7E,9E,11Z,13E-EICOSATETRAENOIC ACID,METHYL ESTER |
| 7,9,11,13-Eicosatetraenoic acid, 5,6,15-trihydroxy-, methyl ester, (5S,6R,7E,9E,11Z,13E,15S)- |
| Methyl (5S,6R,7E,9E,11Z,13E,15S)-5,6,15-trihydroxy-7,9,11,13-icosatetraenoate |