2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid
![2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid Structure](https://image.chemsrc.com/caspic/312/97656-05-8.png)
2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid structure
|
Common Name | 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 97656-05-8 | Molecular Weight | 426.46100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-[(2-Carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid (CAS number: 97656-05-8), molecular formula C18H18O8S2, molecular weight 426.46100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H18O8S2 |
|---|---|
| Molecular Weight | 426.46100 |
| Exact Mass | 426.04400 |
| PSA | 162.12000 |
| LogP | 3.91680 |
| InChIKey | ADJQNFBCZKPRGR-UHFFFAOYSA-N |
| SMILES | COc1cc(SSc2cc(OC)c(OC)cc2C(=O)O)c(C(=O)O)cc1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-[(2-carboxy-4... CAS#:97656-05-8 |
| Literature: ORION CORPORATION Patent: WO2007/10085 A2, 2007 ; Location in patent: Page/Page column 32-33 ; |
|
~%
2-[(2-carboxy-4... CAS#:97656-05-8 |
| Literature: Szabo; Vinkler Acta Chimica Academiae Scientiarum Hungaricae, 1958 , vol. 17, p. 201,207 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![2-[2-(3-azabicyclo[3.2.2]nonan-3-yl)ethyl]-5,6-dimethoxy-1,2-benzothiazol-3-one structure](https://image.chemsrc.com/caspic/179/71998-53-3.png)
CAS#:71998-53-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4',5,5'-tetramethoxy-2,2'-dithiobis(benzoic acid) |
| Bis-(2-carboxy-4,5-dimethoxy-phenyl)-disulfid |
| Benzoic acid,2,2'-dithiobis[4,5-dimethoxy |
| 4,5,4',5'-tetramethoxy-2,2'-disulfanediyl-di-benzoic acid |
| 4,5,4',5'-Tetramethoxy-2,2'-disulfandiyl-di-benzoesaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid? |
| A: Related upstream materials(CAS) of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid: 5653-40-7. |
| Q: What is the English name of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid? |
| A: The English name of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid is 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid. |
| Q: What is the polar surface area (PSA) of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid? |
| A: Polar surface area (PSA) of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid is 162.12000. |
| Q: What English synonyms does 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid have? |
| A: English synonyms of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid: 4,4',5,5'-tetramethoxy-2,2'-dithiobis(benzoic acid), Bis-(2-carboxy-4,5-dimethoxy-phenyl)-disulfid, Benzoic acid,2,2'-dithiobis[4,5-dimethoxy, 4,5,4',5'-tetramethoxy-2,2'-disulfanediyl-di-benzoic acid, 4,5,4',5'-Tetramethoxy-2,2'-disulfandiyl-di-benzoesaeure. |
| Q: What is the SMILES notation of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid? |
| A: SMILES notation of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid is COc1cc(SSc2cc(OC)c(OC)cc2C(=O)O)c(C(=O)O)cc1OC. |
| Q: What is the molecular formula of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid? |
| A: Molecular formula of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid is C18H18O8S2. |
| Q: What is the Chinese name of 97656-05-8? |
| A: Chinese name of 97656-05-8 is 97656-05-8. |
| Q: What is the InChIKey of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid? |
| A: InChIKey of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid is ADJQNFBCZKPRGR-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid? |
| A: CAS number of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid is 97656-05-8. |
| Q: What are the downstream products of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid? |
| A: Related downstream products(CAS) of 2-[(2-carboxy-4,5-dimethoxyphenyl)disulfanyl]-4,5-dimethoxybenzoic acid: 71998-53-3. |