N-(2,4-dichlorophenyl)benzenecarboximidoyl chloride structure
|
Common Name | N-(2,4-dichlorophenyl)benzenecarboximidoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 97661-67-1 | Molecular Weight | 284.56800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8Cl3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,4-dichlorophenyl)benzenecarboximidoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8Cl3N |
|---|---|
| Molecular Weight | 284.56800 |
| Exact Mass | 282.97200 |
| PSA | 12.36000 |
| LogP | 5.31050 |
| InChIKey | HNQVXSDILBBLQP-UHFFFAOYSA-N |
| SMILES | ClC(=Nc1ccc(Cl)cc1Cl)c1ccccc1 |
|
~%
N-(2,4-dichloro... CAS#:97661-67-1 |
| Literature: Chapman Journal of the Chemical Society, 1927 , p. 1748 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Benzenecarboximidoyl chloride,N-(2,4-dichlorophenyl) |
| Benzoesaeure-(2.4-dichlor-phenylimid)-chlorid |
| N-(2.4-Dichlor-phenyl)-benzimidchlorid |
| N-(2,4-dichloro-phenyl)-benzimidoyl chloride |
| N-(2,4-Dichlor-phenyl)-benzimidoylchlorid |