4-chloro-N-methyl-N-nitrosobenzamide
4-chloro-N-methyl-N-nitrosobenzamide structure
|
Common Name | 4-chloro-N-methyl-N-nitrosobenzamide | ||
|---|---|---|---|---|
| CAS Number | 97661-68-2 | Molecular Weight | 198.60600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-Chloro-N-methyl-N-nitrosobenzamide (CAS number: 97661-68-2), with molecular formula C8H7ClN2O2 and molecular weight 198.60600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-N-methyl-N-nitrosobenzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7ClN2O2 |
|---|---|
| Molecular Weight | 198.60600 |
| Exact Mass | 198.02000 |
| PSA | 49.74000 |
| LogP | 2.09340 |
| InChIKey | GRCLEBWPHGBMMY-UHFFFAOYSA-N |
| SMILES | CN(N=O)C(=O)c1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-chloro-N-meth... CAS#:97661-68-2 |
| Literature: Iley, Jim; Carvalho, Emilia; Norberto, Fatima; Rosa, Eduarda Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1992 , # 2 p. 281 - 290 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzamide,4-chloro-N-methyl-N-nitroso |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-chloro-N-methyl-N-nitrosobenzamide? |
| A: Molecular formula of 4-chloro-N-methyl-N-nitrosobenzamide is C8H7ClN2O2. |
| Q: What is the Chinese name of 97661-68-2? |
| A: Chinese name of 97661-68-2 is 97661-68-2. |
| Q: What is the English name of 4-chloro-N-methyl-N-nitrosobenzamide? |
| A: The English name of 4-chloro-N-methyl-N-nitrosobenzamide is 4-chloro-N-methyl-N-nitrosobenzamide. |
| Q: What is the LogP of 4-chloro-N-methyl-N-nitrosobenzamide? |
| A: LogP of 4-chloro-N-methyl-N-nitrosobenzamide is 2.09340. |
| Q: What is the molecular weight of 4-chloro-N-methyl-N-nitrosobenzamide? |
| A: Molecular weight of 4-chloro-N-methyl-N-nitrosobenzamide is 198.60600. |
| Q: What is the CAS number of 4-chloro-N-methyl-N-nitrosobenzamide? |
| A: CAS number of 4-chloro-N-methyl-N-nitrosobenzamide is 97661-68-2. |
| Q: What is the SMILES notation of 4-chloro-N-methyl-N-nitrosobenzamide? |
| A: SMILES notation of 4-chloro-N-methyl-N-nitrosobenzamide is CN(N=O)C(=O)c1ccc(Cl)cc1. |
| Q: What English synonyms does 4-chloro-N-methyl-N-nitrosobenzamide have? |
| A: English synonyms of 4-chloro-N-methyl-N-nitrosobenzamide: Benzamide,4-chloro-N-methyl-N-nitroso. |
| Q: What is the InChIKey of 4-chloro-N-methyl-N-nitrosobenzamide? |
| A: InChIKey of 4-chloro-N-methyl-N-nitrosobenzamide is GRCLEBWPHGBMMY-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4-chloro-N-methyl-N-nitrosobenzamide? |
| A: Polar surface area (PSA) of 4-chloro-N-methyl-N-nitrosobenzamide is 49.74000. |