4-(4-bromophenyl)-1-tert-butyl-3,5,8-trioxabicyclo[2.2.2]octane structure
|
Common Name | 4-(4-bromophenyl)-1-tert-butyl-3,5,8-trioxabicyclo[2.2.2]octane | ||
|---|---|---|---|---|
| CAS Number | 97720-09-7 | Molecular Weight | 327.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-bromophenyl)-1-tert-butyl-3,5,8-trioxabicyclo[2.2.2]octane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H19BrO3 |
|---|---|
| Molecular Weight | 327.21400 |
| Exact Mass | 326.05200 |
| PSA | 27.69000 |
| LogP | 3.66890 |
| InChIKey | WVJTXFQAOGLCIC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C12COC(c3ccc(Br)cc3)(OC1)OC2 |
| p-Bromoorthobenzoic acid cyclic ester with 2-tert-butyl-2-(hydroxymethyl)-1,3-propanediol |
| 1-(4-Bromophenyl)-4-tert-butylbicycloorthocarboxylate |
| Orthobenzoic acid,p-bromo-,cyclic ester with 2-tert-butyl-2-(hydroxymethyl)-1,3-propanediol |
| 2,6,7-Trioxabicyclo(2.2.2)octane,1-(4-bromophenyl)-4-(1,1-dimethylethyl) |